For research use only. Not for therapeutic Use.
Methyl 4-aminocyclohexanecarboxylate(CAT: L019306) is a cyclohexane-based ester commonly used as an intermediate in organic synthesis, particularly in the pharmaceutical industry. Its structure includes a cyclohexane ring with an amino group at the 4-position and a methyl ester at the carboxylate position, making it a versatile starting material for the development of bioactive molecules, such as pharmaceutical agents and agrochemicals. The amino group allows for further functionalization through acylation or alkylation, while the ester group can be hydrolyzed or transformed into amides or other derivatives. Methyl 4-aminocyclohexanecarboxylate is valued for its ability to serve as a building block in synthesizing compounds targeting neurological and cardiovascular pathways.
CAS Number | 62456-15-9 |
Molecular Formula | C8H15NO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-aminocyclohexane-1-carboxylate |
InChI | InChI=1S/C8H15NO2/c1-11-8(10)6-2-4-7(9)5-3-6/h6-7H,2-5,9H2,1H3 |
InChIKey | FFKGMXGWLOPOAO-UHFFFAOYSA-N |