For research use only. Not for therapeutic Use.
Methyl 4-aminonaphthalene-2-carboxylate(Cat No.:L007309), is a chemical compound with important applications in organic synthesis and the pharmaceutical industry. This compound serves as a valuable building block for the preparation of various functionalized naphthalene derivatives. Its amino group can participate in a wide range of chemical reactions, allowing for the synthesis of complex molecules used in medicinal chemistry. Researchers and chemists utilize this compound as a key intermediate in the synthesis of pharmaceutical drugs, dyes, and agrochemicals. Its versatile reactivity and ability to form diverse compounds make it a valuable tool in the development of new materials and bioactive molecules.
CAS Number | 91569-21-0 |
Molecular Formula | C12H11NO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-aminonaphthalene-2-carboxylate |
InChI | InChI=1S/C12H11NO2/c1-15-12(14)9-6-8-4-2-3-5-10(8)11(13)7-9/h2-7H,13H2,1H3 |
InChIKey | ITAMEXWVHLBNFG-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC2=CC=CC=C2C(=C1)N |