For research use only. Not for therapeutic Use.
Methyl 4-benzoylbenzoate (Cat.No:L004059) is a key chemical compound with versatile applications. Its distinct structure, featuring both benzoyl and methyl ester functionalities, imparts unique reactivity and properties. This compound serves as a valuable building block in the synthesis of specialized organic molecules, finding applications in pharmaceutical and chemical research.
CAS Number | 6158-54-9 |
Molecular Formula | C15H12O3 |
Purity | ≥95% |
IUPAC Name | methyl 4-benzoylbenzoate |
InChI | InChI=1S/C15H12O3/c1-18-15(17)13-9-7-12(8-10-13)14(16)11-5-3-2-4-6-11/h2-10H,1H3 |
InChIKey | UPXFXAMIFNGJLD-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |