For research use only. Not for therapeutic Use.
Methyl 4-bromo-1,2,5-thiadiazole-3-carboxylate(Cat No.:M105297)is a brominated heterocyclic compound featuring a thiadiazole ring with a bromine atom at the 4-position and a carboxylate ester group at the 3-position. This compound is valuable in pharmaceutical research and organic synthesis as an intermediate for creating bioactive molecules, including potential drug candidates and agrochemicals. The presence of the bromine atom allows for further functionalization through cross-coupling reactions, while the ester group provides versatility in chemical transformations. High purity ensures consistent performance in advanced research and chemical development applications.
CAS Number | 152300-56-6 |
Molecular Formula | C4H3BrN2O2S |
Purity | ≥95% |
IUPAC Name | methyl 4-bromo-1,2,5-thiadiazole-3-carboxylate |
InChI | InChI=1S/C4H3BrN2O2S/c1-9-4(8)2-3(5)7-10-6-2/h1H3 |
InChIKey | HJPUHNZGOZGRMJ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=NSN=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |