For research use only. Not for therapeutic Use.
Methyl 4-bromo-1H-pyrazole-3-carboxylate is an aromatic pyrazole derivative featuring a bromine substituent at the 4-position and a methyl ester at the 3-position. This compound exhibits significant reactivity, making it valuable in organic synthesis and medicinal chemistry. The bromine atom can facilitate nucleophilic substitution reactions, while the carboxylate group allows for further transformations, such as esterification or amidation. This compound may serve as an important intermediate in the development of pharmaceuticals, agrochemicals, and other functional materials.
CAS Number | 190263-20-8 |
Molecular Formula | C5H5BrN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 4-bromo-1H-pyrazole-5-carboxylate |
InChI | InChI=1S/C5H5BrN2O2/c1-10-5(9)4-3(6)2-7-8-4/h2H,1H3,(H,7,8) |
InChIKey | KWQDACZQHJCUNK-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=NN1)Br |