For research use only. Not for therapeutic Use.
Methyl 4-(bromomethyl)-2-methoxybenzoate is an aromatic ester featuring a methoxy group at the 2-position and a bromomethyl substituent at the 4-position on the benzoate ring. This unique arrangement enhances its reactivity, making it useful in organic synthesis for various transformations, such as nucleophilic substitution reactions. The presence of the bromomethyl group allows for further derivatization, while the methoxy group can influence solubility and electronic properties. This compound may serve as a valuable intermediate in pharmaceutical and agrochemical development.
CAS Number | 74733-27-0 |
Molecular Formula | C10H11BrO3 |
Purity | ≥95% |
IUPAC Name | methyl 4-(bromomethyl)-2-methoxybenzoate |
InChI | InChI=1S/C10H11BrO3/c1-13-9-5-7(6-11)3-4-8(9)10(12)14-2/h3-5H,6H2,1-2H3 |
InChIKey | DCXFLSHDURQRML-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)CBr)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |