For research use only. Not for therapeutic Use.
Methyl 4-Bromophenylacetate (Cat.No:R001282) is a chemical compound used as a versatile building block in organic synthesis. With a bromine-substituted phenyl group and an acetate functional group, it serves as an intermediate for the preparation of diverse molecules in pharmaceutical and chemical research, contributing to the development of new compounds.
| Catalog Number | R001282 |
| CAS Number | 41841-16-1 |
| Synonyms | 4-Bromophenylacetic Acid, Methyl Ester |
| Molecular Formula | C9H9BrO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl 2-(4-bromophenyl)acetate |
| InChI | InChI=1S/C9H9BrO2/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5H,6H2,1H3 |
| InChIKey | QHJOWSXZDCTNQX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)Br |
