For research use only. Not for therapeutic Use.
Methyl 4-butyrylbenzoate(Cat No.:L022427)is an aromatic ester used in organic synthesis and pharmaceutical research. This compound features a benzoate core with a butyryl group at the 4-position and a methyl ester group, making it a versatile intermediate in the production of various bioactive molecules. It is often employed in the synthesis of fine chemicals, fragrances, and potential drug candidates. The combination of the butyryl and methyl ester functionalities allows for diverse chemical transformations, making it valuable in the development of new materials and medicinal chemistry applications.
CAS Number | 71616-83-6 |
Molecular Formula | C12H14O3 |
Purity | ≥95% |
IUPAC Name | methyl 4-butanoylbenzoate |
InChI | InChI=1S/C12H14O3/c1-3-4-11(13)9-5-7-10(8-6-9)12(14)15-2/h5-8H,3-4H2,1-2H3 |
InChIKey | KTZOAXDUBMENLM-UHFFFAOYSA-N |
SMILES | CCCC(=O)C1=CC=C(C=C1)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |