For research use only. Not for therapeutic Use.
Methyl 4-chloro-1-hydroxy-2-naphthoate (Cat.No:L004172) is a crucial compound with diverse applications. Its unique structure, incorporating a chloro-naphthoate moiety, imparts specialized reactivity. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules, with potential applications in pharmaceutical and chemical research.
Catalog Number | L004172 |
CAS Number | 135241-08-6 |
Molecular Formula | C12H9ClO3 |
Purity | ≥95% |
IUPAC Name | methyl 4-chloro-1-hydroxynaphthalene-2-carboxylate |
InChI | InChI=1S/C12H9ClO3/c1-16-12(15)9-6-10(13)7-4-2-3-5-8(7)11(9)14/h2-6,14H,1H3 |
InChIKey | YXHHYWLUQOYFSN-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C2=CC=CC=C2C(=C1)Cl)O |