Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 4-chloro-2-methylquinoline-8-carboxylate
For research use only. Not for therapeutic Use.
Methyl 4-chloro-2-methylquinoline-8-carboxylate(Cat No.:L019048)is a chemical compound featuring a quinoline core substituted with chlorine and methyl groups and an ester group at the 8-position. This structure enhances the molecule’s electronic properties and reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals, especially those targeting antimicrobial and anti-inflammatory pathways. The ester group increases solubility and facilitates diverse chemical transformations, while the chlorine and methyl substitutions on the quinoline ring contribute to the compound’s stability and potential biological activity. This compound is instrumental in developing new therapeutic agents with improved efficacy.
CAS Number | 1234818-35-9 |
Molecular Formula | C12H10ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-chloro-2-methylquinoline-8-carboxylate |
InChI | InChI=1S/C12H10ClNO2/c1-7-6-10(13)8-4-3-5-9(11(8)14-7)12(15)16-2/h3-6H,1-2H3 |
InChIKey | XGKKOOISRLHZEN-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C=CC=C(C2=N1)C(=O)OC)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |