For research use only. Not for therapeutic Use.
Methyl 4-chloro-6-fluoropyridine-2-carboxylate(CAT: L000158) is a compound with applications in organic chemistry. Its action mechanism involves serving as a valuable intermediate for the synthesis of various organic compounds. This compound is important for the development of complex organic molecules and is used as a building block for creating specialized chemical structures.
CAS Number | 1256810-49-7 |
Molecular Formula | C7H5ClFNO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-chloro-6-fluoropyridine-2-carboxylate |
InChI | InChI=1S/C7H5ClFNO2/c1-12-7(11)5-2-4(8)3-6(9)10-5/h2-3H,1H3 |
InChIKey | RSKKNJAYJNVNCF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |