For research use only. Not for therapeutic Use.
Methyl 4-(chloromethyl)nicotinate hydrochloride(CAT: L000336) is a compound of significance in the field of organic chemistry and pharmaceuticals. This chemical, which combines a nicotinate core with a chloromethyl group, is frequently employed as a crucial intermediate in the synthesis of various pharmaceuticals. It plays a pivotal role in the pharmaceutical industry, serving as a key building block for the development of drugs with diverse therapeutic applications.
CAS Number | 1159826-53-5 |
Molecular Formula | C8H9Cl2NO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-(chloromethyl)pyridine-3-carboxylate;hydrochloride |
InChI | InChI=1S/C8H8ClNO2.ClH/c1-12-8(11)7-5-10-3-2-6(7)4-9;/h2-3,5H,4H2,1H3;1H |
InChIKey | ZZSNROUQNZMZIA-UHFFFAOYSA-N |