For research use only. Not for therapeutic Use.
Methyl 4-cyanobenzoate is a chemical compound that consists of a benzoate ester substituted with a cyanide group at the para position. This compound is frequently used as an intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. Its cyano and ester functional groups allow for various chemical transformations, making it valuable for constructing more complex molecules. Its applications include the synthesis of aromatic compounds, dyes, and polymers, where its specific reactivity is leveraged.
CAS Number | 1129-35-7 |
Synonyms | 4-Cyanobenzoic Acid Methyl Ester; p-Cyanobenzoic Acid Methyl Ester; 4-(Methoxycarbonyl)benzonitrile; Methyl p-Cyanobenzoate; p-Cyanobenzoic Acid Methyl Ester; |
Molecular Formula | C9H7NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 4-cyanobenzoate |
InChI | InChI=1S/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
InChIKey | KKZMIDYKRKGJHG-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |