For research use only. Not for therapeutic Use.
Methyl (4-cyanophenyl)acetate(CAT: L029585) is an organic compound featuring a methyl ester group attached to a phenyl ring, which is substituted with a cyano group (-CN) at the 4-position. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. The cyano group adds electron-withdrawing properties, which can influence the reactivity of the molecule in various reactions. Additionally, the methyl ester group makes it suitable for further chemical modifications. Its structure and reactivity make it valuable in organic synthesis, particularly in the development of aromatic compounds and functionalized materials.
CAS Number | 52798-01-3 |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(4-cyanophenyl)acetate |
InChI | InChI=1S/C10H9NO2/c1-13-10(12)6-8-2-4-9(7-11)5-3-8/h2-5H,6H2,1H3 |
InChIKey | OHTZXQYRHDVXLJ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |