For research use only. Not for therapeutic Use.
Methyl 4-formylcubane-1-carboxylate (Cat.No:L004133) is a pivotal compound in organic synthesis. Its unique cubane-based structure, featuring a formyl group, imparts distinctive reactivity. This compound serves as a crucial intermediate in the preparation of specialized organic molecules with potential applications in pharmaceutical and chemical research.
CAS Number | 211635-35-7 |
Molecular Formula | C11H10O3 |
Purity | ≥95% |
IUPAC Name | methyl 4-formylcubane-1-carboxylate |
InChI | InChI=1S/C11H10O3/c1-14-9(13)11-6-3-7(11)5-8(11)4(6)10(3,5)2-12/h2-8H,1H3 |
InChIKey | QVULKFAPHFCDQB-UHFFFAOYSA-N |
SMILES | COC(=O)C12C3C4C1C5C2C3C45C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |