For research use only. Not for therapeutic Use.
Methyl 4-hydroxypicolinate is a pyridine derivative featuring a hydroxyl group at the 4-position and a methyl ester at the carboxylic acid position. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate for developing various bioactive molecules. The hydroxyl group enhances reactivity and solubility, while the methyl ester facilitates further chemical transformations. Its structure allows for versatile modifications, making it valuable in the synthesis of pharmaceuticals and agrochemicals, as well as in chemical research applications.
CAS Number | 473269-77-1 |
Molecular Formula | C7H7NO3 |
Purity | ≥95% |
IUPAC Name | methyl 4-oxo-1H-pyridine-2-carboxylate |
InChI | InChI=1S/C7H7NO3/c1-11-7(10)6-4-5(9)2-3-8-6/h2-4H,1H3,(H,8,9) |
InChIKey | QCPCORWMMFZMIQ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=O)C=CN1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |