For research use only. Not for therapeutic Use.
Methyl-4-iodo-3-hydroxybenzoate (Cat.No:M104992) is a chemical compound used as a building block in organic synthesis. It features an iodine-substituted benzene ring and a hydroxyl group, making it valuable for creating diverse molecules in medicinal and chemical research. This compound’s structural versatility contributes to its applications in drug discovery and materials science.
CAS Number | 157942-12-6 |
Molecular Formula | C8H7IO3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | methyl 3-hydroxy-4-iodobenzoate |
InChI | InChI=1S/C8H7IO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
InChIKey | LXCQVWRESZDFGW-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(C=C1)I)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |