For research use only. Not for therapeutic Use.
Methyl 4-isocyanatobenzoate(Cat No.:L006867), is a chemical compound utilized in organic synthesis and materials science. Its molecular structure includes an isocyanate group attached to a benzoate ester. This compound is valuable in the production of polymers, adhesives, and coatings, where its reactivity enables the creation of cross-linked networks. Chemists use it as a reactive intermediate in the preparation of various organic derivatives, including pharmaceuticals and specialty chemicals. Its isocyanate functionality provides opportunities for diverse chemical transformations, making it a key building block in the synthesis of complex molecules.
CAS Number | 23138-53-6 |
Molecular Formula | C9H7NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | methyl 4-isocyanatobenzoate |
InChI | InChI=1S/C9H7NO3/c1-13-9(12)7-2-4-8(5-3-7)10-6-11/h2-5H,1H3 |
InChIKey | FQDDBYGPHUUTRN-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)N=C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |