For research use only. Not for therapeutic Use.
Methyl 4-methoxyphenylacetate(CAT: L012548) is a high-purity aromatic ester featuring a methoxy-substituted phenyl group and a methyl ester functionality. This compound is widely utilized in pharmaceutical research and organic synthesis as a key intermediate for the development of bioactive molecules, fragrances, and specialty chemicals. Its unique structure and reactivity make it particularly valuable in medicinal chemistry for creating therapeutic agents and exploring novel synthetic pathways. With excellent stability and precise composition, Methyl 4-methoxyphenylacetate ensures reliable performance, making it an indispensable resource for researchers in drug discovery, fine chemical development, and advanced material science.
CAS Number | 23786-14-3 |
Molecular Formula | C10H12O3 |
Purity | ≥95% |
IUPAC Name | methyl 2-(4-methoxyphenyl)acetate |
InChI | InChI=1S/C10H12O3/c1-12-9-5-3-8(4-6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
InChIKey | ZQYLDVNTWDEAJI-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)CC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |