For research use only. Not for therapeutic Use.
Methyl 4-nitro-1H-pyrrole-2-carboxylate is a nitro-substituted pyrrole derivative used in organic synthesis and pharmaceutical research. Its structure, featuring a nitro group at the 4-position and an ester group at the 2-position, makes it a versatile intermediate for creating bioactive molecules and heterocyclic compounds. This compound is often employed in the synthesis of drugs, agrochemicals, and materials science applications. Its unique reactivity allows for further functionalization, supporting advancements in medicinal chemistry and the design of novel therapeutic agents.
CAS Number | 13138-74-4 |
Molecular Formula | C6H6N2O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | methyl 4-nitro-1H-pyrrole-2-carboxylate |
InChI | InChI=1S/C6H6N2O4/c1-12-6(9)5-2-4(3-7-5)8(10)11/h2-3,7H,1H3 |
InChIKey | BRZNAATZQZPGBQ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CN1)[N+](=O)[O-] |