For research use only. Not for therapeutic Use.
Methyl 4-Sulfamoylbenzoate is a key intermediate in the synthesis of various pharmaceuticals, particularly sulfonamide-based drugs. This compound is essential for advanced chemical and pharmaceutical research, enabling the study of drug development and synthesis pathways. Its unique chemical structure allows for the creation of potent therapeutic agents. Methyl 4-Sulfamoylbenzoate is highly valued for its purity and stability, making it an indispensable tool in the production of effective antibiotics, diuretics, and other medicinal compounds.
CAS Number | 22808-73-7 |
Synonyms | p-Sulfamoyl-benzoic Acid Methyl Ester; 4-Methoxycarbonylbenzenesulfonamide; Methyl p-(Aminosulfonyl)benzoate; p-Carboxybenzenesulfonamide Methyl Ester; NSC 251214; |
Molecular Formula | C8H9NO4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 4-sulfamoylbenzoate |
InChI | InChI=1S/C8H9NO4S/c1-13-8(10)6-2-4-7(5-3-6)14(9,11)12/h2-5H,1H3,(H2,9,11,12) |
InChIKey | XLOVNJUCAFIANM-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)S(=O)(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |