For research use only. Not for therapeutic Use.
Methyl 4-toluenesulfonate is a widely used reagent in organic synthesis, valued for its role as a sulfonate leaving group in nucleophilic substitution reactions. Featuring a methyl group and a para-toluenesulfonyl moiety, this compound enhances reactivity and facilitates the formation of various carbon-carbon and carbon-heteroatom bonds. Its stability and ease of use make it a preferred choice in the synthesis of complex molecules, including pharmaceuticals and agrochemicals. Methyl 4-toluenesulfonate is essential for advancing synthetic methodologies in chemical research.
CAS Number | 80-48-8 |
Synonyms | Methyl tosylate, METHYL-P-TOLUENESULFONATE |
Molecular Formula | C8H10O3S |
Purity | ≥95% |
Documentation | |
Storage | RT |
IUPAC Name | methyl 4-methylbenzenesulfonate |
InChI | InChI=1S/C8H10O3S/c1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3 |
InChIKey | VUQUOGPMUUJORT-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC |