Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 4,5-dibromo-3-chlorothiophene-2-carboxylate
For research use only. Not for therapeutic Use.
Methyl 4,5-dibromo-3-chlorothiophene-2-carboxylate(CAT: L000402) is a crucial compound in the realm of organic chemistry and material chemistry. This molecule serves as a versatile building block in the synthesis of various organic and polymeric materials. Its unique halogenated structure makes it particularly valuable for creating specialized polymers and organic compounds with tailored properties.
CAS Number | 1501789-47-4 |
Molecular Formula | C6H3Br2ClO2S |
Purity | ≥95% |
IUPAC Name | methyl 4,5-dibromo-3-chlorothiophene-2-carboxylate |
InChI | InChI=1S/C6H3Br2ClO2S/c1-11-6(10)4-3(9)2(7)5(8)12-4/h1H3 |
InChIKey | RJQBWMPIDVDQQA-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |