For research use only. Not for therapeutic Use.
Methyl 4,5-dimethoxy-2-nitrobenzoate(CAT: L046974) is an aromatic ester compound featuring a benzoate core with two methoxy groups at the 4- and 5-positions and a nitro group at the 2-position. This compound is frequently used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. The methoxy groups increase the electron density on the aromatic ring, while the nitro group introduces electron-withdrawing properties, resulting in a molecule with distinct reactivity patterns. The ester functionality allows for potential hydrolysis to yield the corresponding carboxylic acid, enabling further derivatization. This compound’s unique substitution pattern makes it useful in studies involving aromatic substitution reactions, as well as in synthesizing more complex molecules for medicinal and materials chemistry applications.
CAS Number | 26791-93-5 |
Molecular Formula | C10H11NO6 |
Purity | ≥95% |
IUPAC Name | methyl 4,5-dimethoxy-2-nitrobenzoate |
InChI | InChI=1S/C10H11NO6/c1-15-8-4-6(10(12)17-3)7(11(13)14)5-9(8)16-2/h4-5H,1-3H3 |
InChIKey | SYYKLKHBZGFKOC-UHFFFAOYSA-N |