For research use only. Not for therapeutic Use.
Methyl 5-amino-1H-indole-6-carboxylate (Cat.No:L003881) is a pivotal compound in pharmaceutical research. Its distinct indole structure, combined with an amino and ester functionality, grants it unique reactivity. This compound serves as a valuable intermediate in the synthesis of specialized molecules with potential therapeutic applications.
CAS Number | 1638767-58-4 |
Molecular Formula | C10H10N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-amino-1H-indole-6-carboxylate |
InChI | InChI=1S/C10H10N2O2/c1-14-10(13)7-5-9-6(2-3-12-9)4-8(7)11/h2-5,12H,11H2,1H3 |
InChIKey | BUEHYNPNQVZAJA-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C2C=CNC2=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |