For research use only. Not for therapeutic Use.
Methyl 5-Amino-2-bromo-4-chlorobenzoate(Cat No.:L037508)is a halogenated aromatic ester featuring an amino group at the 5-position, a bromine atom at the 2-position, and a chlorine atom at the 4-position on a benzoate ring. This compound is valuable in pharmaceutical research and organic synthesis as a versatile intermediate for developing bioactive molecules, including potential drug candidates. The combination of amino, bromo, and chloro groups allows for diverse chemical modifications, making it useful in creating complex molecular structures. Its high purity ensures consistent performance in advanced research and medicinal chemistry applications.
CAS Number | 929524-50-5 |
Molecular Formula | C8H7BrClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 5-amino-2-bromo-4-chlorobenzoate |
InChI | InChI=1S/C8H7BrClNO2/c1-13-8(12)4-2-7(11)6(10)3-5(4)9/h2-3H,11H2,1H3 |
InChIKey | XUZCITBAERDTOB-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(C=C1Br)Cl)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |