For research use only. Not for therapeutic Use.
Methyl 5-bromo-1-methyl-1H-pyrrole-2-carboxylate is a brominated pyrrole derivative featuring a methyl group at the 1st position and an ester group at the 2nd position. The bromine atom at the 5th position enhances the compound’s reactivity, making it a useful intermediate in organic synthesis. This compound is commonly used in pharmaceutical and agrochemical research for the development of bioactive molecules. Its structure allows for functionalization in various reactions, making it valuable for creating complex compounds in drug discovery and material science.
CAS Number | 1196-07-2 |
Synonyms | Methyl 5-broMo-1-Methyl-1H-pyrrole-2-carboxylate |
Molecular Formula | C7H8BrNO2 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | methyl 5-bromo-1-methylpyrrole-2-carboxylate |
InChI | InChI=1S/C7H8BrNO2/c1-9-5(7(10)11-2)3-4-6(9)8/h3-4H,1-2H3 |
InChIKey | NMJMIZMIPRJDDV-UHFFFAOYSA-N |
SMILES | CN1C(=CC=C1Br)C(=O)OC |