For research use only. Not for therapeutic Use.
Methyl 5-Bromo-3-Methylpicolinate(CAT: L032372) is a high-purity brominated pyridine derivative widely used in pharmaceutical and chemical research. Featuring a methyl ester functional group and bromine substitution on the pyridine ring, this compound is a versatile intermediate for synthesizing bioactive molecules and complex organic compounds. It is particularly valuable in medicinal chemistry for the development of novel therapeutic agents and in cross-coupling reactions such as Suzuki-Miyaura. With excellent stability and reactivity, Methyl 5-Bromo-3-Methylpicolinate ensures precision and reliability, making it an essential tool for advanced synthetic and research applications.
CAS Number | 213771-32-5 |
Molecular Formula | C8H8BrNO2 |
Purity | ≥95% |
IUPAC Name | methyl 5-bromo-3-methylpyridine-2-carboxylate |
InChI | InChI=1S/C8H8BrNO2/c1-5-3-6(9)4-10-7(5)8(11)12-2/h3-4H,1-2H3 |
InChIKey | KZPOANNAYCXMSH-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1C(=O)OC)Br |