For research use only. Not for therapeutic Use.
Methyl 5-bromo-4-fluorothiophene-2-carboxylate（Cat No.:L016496）is a heterocyclic compound used in organic synthesis and pharmaceutical research. The molecule features a thiophene ring substituted with a bromine atom at the 5-position, a fluorine atom at the 4-position, and a methyl ester group at the 2-position. This combination of halogens and an ester group provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its structure allows for versatile chemical modifications, essential for researchers focused on drug discovery and medicinal chemistry.
| Catalog Number | L016496 |
| CAS Number | 395664-59-2 |
| Molecular Formula | C6H4BrFO2S |
| Purity | ≥95% |
| IUPAC Name | methyl 5-bromo-4-fluorothiophene-2-carboxylate |
| InChI | InChI=1S/C6H4BrFO2S/c1-10-6(9)4-2-3(8)5(7)11-4/h2H,1H3 |
| InChIKey | KYNGYTAEUYSZEE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)Br)F |
