Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 5-bromo-4-methyl-1H-pyrazole-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 5-bromo-4-methyl-1H-pyrazole-3-carboxylate(Cat No.:L016632)is a high-purity compound widely used in pharmaceutical research and organic synthesis. This brominated pyrazole derivative is an essential intermediate for developing bioactive molecules, particularly in the synthesis of heterocyclic compounds with therapeutic potential. Its structure, featuring both bromine and ester functionalities, allows for selective reactions and modifications, making it valuable in medicinal chemistry. Methyl 5-bromo-4-methyl-1H-pyrazole-3-carboxylate is crucial for research focused on creating new drug candidates and optimizing synthetic routes.
Catalog Number | L016632 |
CAS Number | 1779345-41-3 |
Molecular Formula | C6H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-bromo-4-methyl-1H-pyrazole-3-carboxylate |
InChI | InChI=1S/C6H7BrN2O2/c1-3-4(6(10)11-2)8-9-5(3)7/h1-2H3,(H,8,9) |
InChIKey | MYXBGWOVGGXULH-UHFFFAOYSA-N |
SMILES | CC1=C(NN=C1C(=O)OC)Br |