For research use only. Not for therapeutic Use.
Methyl 5-bromo-6-fluoronicotinate is a halogenated nicotinic acid ester featuring both bromine and fluorine atoms on the pyridine ring, commonly used in pharmaceutical and agrochemical research. Its structure allows for versatile reactivity, particularly in cross-coupling reactions, making it valuable as an intermediate in synthesizing complex bioactive molecules. This compound is often employed in medicinal chemistry for developing enzyme inhibitors and receptor ligands. Its stability and functional diversity make it ideal for use in drug discovery and organic synthesis applications.
CAS Number | 405939-62-0 |
Molecular Formula | C7H5BrFNO2 |
Purity | ≥95% |
IUPAC Name | methyl 5-bromo-6-fluoropyridine-3-carboxylate |
InChI | InChI=1S/C7H5BrFNO2/c1-12-7(11)4-2-5(8)6(9)10-3-4/h2-3H,1H3 |
InChIKey | CUUXTVUEKYOYNI-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(N=C1)F) |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |