For research use only. Not for therapeutic Use.
Methyl 5-chloro-1H-pyrazole-3-carboxylate(Cat No.:L027810)is a heterocyclic compound widely used in organic synthesis and pharmaceutical research. The molecule features a pyrazole ring with a chlorine atom at the 5-position and a carboxylate ester group at the 3-position, offering unique reactivity and versatility. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates. The combination of the chloro and ester functionalities allows for diverse chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
Catalog Number | L027810 |
CAS Number | 1810069-85-2 |
Molecular Formula | C5H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-chloro-1H-pyrazole-3-carboxylate |
InChI | InChI=1S/C5H5ClN2O2/c1-10-5(9)3-2-4(6)8-7-3/h2H,1H3,(H,7,8) |
InChIKey | ZFNADPKSSZLUBR-UHFFFAOYSA-N |
SMILES | COC(=O)C1=NNC(=C1)Cl |