For research use only. Not for therapeutic Use.
Methyl 5-cyano-1H-indole-6-carboxylate (Cat.No:L003416) is a key compound in pharmaceutical research. Its indole scaffold, bearing a cyano group, makes it a valuable building block in drug discovery. This structure is known for its diverse pharmacological activities, highlighting its significance in the development of potential therapeutic agents. Its versatile applications underscore its importance in medicinal chemistry.
Catalog Number | L003416 |
CAS Number | 1227267-07-3 |
Molecular Formula | C11H8N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-cyano-1H-indole-6-carboxylate |
InChI | InChI=1S/C11H8N2O2/c1-15-11(14)9-5-10-7(2-3-13-10)4-8(9)6-12/h2-5,13H,1H3 |
InChIKey | SJSXUVJIRVXRNT-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C2C=CNC2=C1)C#N |