Home
>
Chemical Reagents>Heterocyclic Building Blocks> methyl 5-cyclopropyl-1H-pyrazole-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 5-cyclopropyl-1H-pyrazole-3-carboxylate(Cat No.:L038719)is a specialized chemical compound essential for pharmaceutical research and development. Featuring a cyclopropyl-substituted pyrazole ring, this compound serves as a key intermediate in the synthesis of various bioactive molecules, particularly in the development of anti-inflammatory and antiviral agents. Its unique structure facilitates the exploration of new therapeutic candidates and the study of biological mechanisms. This compound is highly valued in medicinal chemistry for its versatility and potential to contribute to innovative drug discovery efforts.
CAS Number | 1036733-11-5 |
Molecular Formula | C8H10N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-cyclopropyl-1H-pyrazole-3-carboxylate |
InChI | InChI=1S/C8H10N2O2/c1-12-8(11)7-4-6(9-10-7)5-2-3-5/h4-5H,2-3H2,1H3,(H,9,10) |
InChIKey | JTJFTOJFVQTOQD-UHFFFAOYSA-N |
SMILES | COC(=O)C1=NNC(=C1)C2CC2 |