For research use only. Not for therapeutic Use.
Methyl 5-fluoro-2-(2-methoxy-2-oxoethyl)benzoate(Cat No.:L010660)is an aromatic ester used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. This compound features a fluorine atom at the 5-position and a methoxy-oxoethyl group at the 2-position on the benzoate ring, with a methyl ester functional group. Its structure provides reactivity that is valuable in the development of bioactive molecules, particularly in medicinal chemistry. The compound is often utilized in the creation of complex organic molecules, contributing to drug discovery and the synthesis of advanced materials.
CAS Number | 2326068-11-3 |
Molecular Formula | C11H11FO4 |
Purity | ≥95% |
IUPAC Name | methyl 5-fluoro-2-(2-methoxy-2-oxoethyl)benzoate |
InChI | InChI=1S/C11H11FO4/c1-15-10(13)5-7-3-4-8(12)6-9(7)11(14)16-2/h3-4,6H,5H2,1-2H3 |
InChIKey | MFNMAVPCIBTFRK-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=C(C=C(C=C1)F)C(=O)OC |