For research use only. Not for therapeutic Use.
Methyl 5-fluoro-2,6-dihydroxynicotinate is a fluorinated nicotinic acid derivative featuring hydroxyl groups at the 2 and 6 positions, along with a methyl ester at the carboxylate. This compound is notable in medicinal chemistry for its potential biological activities, including anti-inflammatory and neuroprotective effects. The presence of the fluorine atom enhances lipophilicity and metabolic stability, while the hydroxyl groups contribute to solubility and reactivity. Its unique structure allows for diverse modifications, making it valuable in drug development and synthetic chemistry.
CAS Number | 148874-68-4 |
Molecular Formula | C7H6FNO4 |
Purity | ≥95% |
IUPAC Name | methyl 5-fluoro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
InChI | InChI=1S/C7H6FNO4/c1-13-7(12)3-2-4(8)6(11)9-5(3)10/h2H,1H3,(H2,9,10,11) |
InChIKey | ZSFQAJJFUBORSF-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(NC(=O)C(=C1)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |