For research use only. Not for therapeutic Use.
Methyl 5-iodo-2-methoxy-4-methylbenzoate(Cat No.:L037657)is a high-purity aromatic ester commonly used in pharmaceutical and chemical research. This compound features an iodine atom, a methoxy group, and a methyl group on a benzoate core, making it a valuable intermediate in the synthesis of complex organic molecules, including potential drug candidates and fine chemicals. Its unique structure allows for specific reactivity in various chemical transformations, supporting the development of novel therapeutic agents. Methyl 5-iodo-2-methoxy-4-methylbenzoate is ideal for precise synthetic applications in medicinal chemistry.
CAS Number | 914225-32-4 |
Molecular Formula | C10H11IO3 |
Purity | ≥95% |
IUPAC Name | methyl 5-iodo-2-methoxy-4-methylbenzoate |
InChI | InChI=1S/C10H11IO3/c1-6-4-9(13-2)7(5-8(6)11)10(12)14-3/h4-5H,1-3H3 |
InChIKey | NPCVNRLZZVVKNV-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1I)C(=O)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |