For research use only. Not for therapeutic Use.
Methyl 5-methylthiophene-2-carboxylate is an aromatic compound characterized by a thiophene ring with a methyl group at the 5-position and a carboxylate group at the 2-position, with a methyl ester functionality. This structure imparts unique chemical properties, making it valuable in organic synthesis and materials science. The carboxylate group can undergo various transformations, such as esterification and nucleophilic substitutions, while the thiophene ring contributes to its electronic characteristics. This compound may serve as an important intermediate in developing pharmaceuticals and agrochemicals.
CAS Number | 19432-69-0 |
Molecular Formula | C7H8O2S |
Purity | ≥95% |
IUPAC Name | methyl 5-methylthiophene-2-carboxylate |
InChI | InChI=1S/C7H8O2S/c1-5-3-4-6(10-5)7(8)9-2/h3-4H,1-2H3 |
InChIKey | NEPZGUGQLAOODR-UHFFFAOYSA-N |
SMILES | CC1=CC=C(S1)C(=O)OC |