For research use only. Not for therapeutic Use.
Methyl 6-bromo-1H-indazole-4-carboxylate(CAT: I012480) is a chemical compound belonging to the indazole class. It is characterized by the presence of a methyl ester group at the 6-position and a bromine atom at the 6-position of the indazole ring. The compound’s structure suggests potential applications in medicinal chemistry and organic synthesis. The specific pharmacological properties, target receptors, and potential applications of methyl 6-bromo-1H-indazole-4-carboxylate would require further investigation and research.
CAS Number | 885518-49-0 |
Synonyms | 6-Bromo-1H-indazole-4-carboxylic acid methyl ester |
Molecular Formula | C9H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 6-bromo-1H-indazole-4-carboxylate |
InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)6-2-5(10)3-8-7(6)4-11-12-8/h2-4H,1H3,(H,11,12) |
InChIKey | FEPRHRPOKPTRQZ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CC2=C1C=NN2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |