For research use only. Not for therapeutic Use.
Methyl 6-bromo-2-methoxynicotinate(Cat No.:L032696)is a brominated nicotinic acid ester used in pharmaceutical and chemical research. Featuring a nicotinate core with a bromine atom at the 6-position and a methoxy group at the 2-position, this compound serves as a valuable intermediate in the synthesis of various bioactive molecules, including potential drugs and agrochemicals. Its unique structure allows for selective chemical modifications, making it crucial in developing complex organic compounds. Additionally, it plays a role in the exploration of novel therapeutic agents and advanced materials in medicinal chemistry.
CAS Number | 1009735-24-3 |
Molecular Formula | C8H8BrNO3 |
Purity | ≥95% |
IUPAC Name | methyl 6-bromo-2-methoxypyridine-3-carboxylate |
InChI | InChI=1S/C8H8BrNO3/c1-12-7-5(8(11)13-2)3-4-6(9)10-7/h3-4H,1-2H3 |
InChIKey | BPQKMODYCOBBPO-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=N1)Br)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |