For research use only. Not for therapeutic Use.
Methyl 6-Bromo-5-nitronicotinate(CAT: L033793) is a high-purity brominated pyridine derivative featuring a nitro group and an ester functionality. This compound is a versatile intermediate widely utilized in pharmaceutical and chemical research. Its unique structure supports the synthesis of bioactive molecules, agrochemicals, and complex organic compounds. Particularly valuable in medicinal chemistry, it enables the development of novel therapeutics and facilitates structure-activity relationship studies. With excellent stability and reactivity, Methyl 6-Bromo-5-nitronicotinate is a reliable choice for precision-driven research and advanced synthetic applications.
CAS Number | 1211519-89-9 |
Molecular Formula | C7H5BrN2O4 |
Purity | ≥95% |
IUPAC Name | methyl 6-bromo-5-nitropyridine-3-carboxylate |
InChI | InChI=1S/C7H5BrN2O4/c1-14-7(11)4-2-5(10(12)13)6(8)9-3-4/h2-3H,1H3 |
InChIKey | DBBBELCPCXHASZ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(N=C1)Br)[N+](=O)[O-] |