Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 6-bromopyrazolo[1,5-A]pyridine-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 6-bromopyrazolo[1,5-a]pyridine-3-carboxylate is an organic compound featuring a pyrazolo-pyridine framework. It has a bromine atom at the sixth position and a methyl ester of a carboxylic acid at the third position. Its chemical formula is C₉H₈BrN₃O₂. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and anti-inflammatory properties. The presence of the bromine and ester functionalities enhances its reactivity, making it a valuable scaffold for further synthetic applications.
CAS Number | 1062368-70-0 |
Molecular Formula | C9H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 6-bromopyrazolo[1,5-a]pyridine-3-carboxylate |
InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)7-4-11-12-5-6(10)2-3-8(7)12/h2-5H,1H3 |
InChIKey | HCGDDQYSLHRKRM-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C2C=CC(=CN2N=C1)Br |