For research use only. Not for therapeutic Use.
Methyl 6-chloro-2-fluoro-3-(trifluoromethyl)benzoate(Cat No.:L013216)is an aromatic ester featuring a chloro group at the 6-position, a fluoro group at the 2-position, and a trifluoromethyl group at the 3-position on the benzoate ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other complex organic molecules. Its unique combination of halogen atoms and ester functionality allows for versatile chemical reactions, making it valuable in medicinal chemistry and materials science. Methyl 6-chloro-2-fluoro-3-(trifluoromethyl)benzoate is essential for advanced research and development in synthetic chemistry.
CAS Number | 1805458-07-4 |
Molecular Formula | C9H5ClF4O2 |
Purity | ≥95% |
IUPAC Name | methyl 6-chloro-2-fluoro-3-(trifluoromethyl)benzoate |
InChI | InChI=1S/C9H5ClF4O2/c1-16-8(15)6-5(10)3-2-4(7(6)11)9(12,13)14/h2-3H,1H3 |
InChIKey | MMOOQXIJQZWRJJ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CC(=C1F)C(F)(F)F)Cl |