For research use only. Not for therapeutic Use.
Methyl 6-chloro-2-(methylsulfonyl)pyrimidine-4-carboxylate(CAT: L029046) is a high-purity heterocyclic compound featuring a chlorinated pyrimidine ring with methylsulfonyl and carboxylate functional groups. This versatile molecule serves as a critical intermediate in pharmaceutical research, particularly in the synthesis of bioactive compounds such as kinase inhibitors and other therapeutic agents. Its unique structure and reactivity make it suitable for diverse chemical transformations, including cross-coupling and nucleophilic substitution reactions. Methyl 6-chloro-2-(methylsulfonyl)pyrimidine-4-carboxylate supports innovative approaches in medicinal chemistry, agrochemical development, and fine chemical production, offering reliability and performance for advanced research applications.
CAS Number | 25742-28-3 |
Molecular Formula | C7H7ClN2O4S |
Purity | ≥95% |
IUPAC Name | methyl 6-chloro-2-methylsulfonylpyrimidine-4-carboxylate |
InChI | InChI=1S/C7H7ClN2O4S/c1-14-6(11)4-3-5(8)10-7(9-4)15(2,12)13/h3H,1-2H3 |
InChIKey | FSQBCNBFHWRUGG-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=NC(=N1)S(=O)(=O)C)Cl |