Home
>
Chemical Reagents>Heterocyclic Building Blocks> methyl 6-chloro-3-formyl-1H-indole-2-carboxylate
For research use only. Not for therapeutic Use.
Methyl 6-chloro-3-formyl-1H-indole-2-carboxylate(Cat No.:L002699)is a key intermediate used in pharmaceutical research and organic synthesis. Featuring a chloro-substituted indole ring, formyl group, and ester functionality, it offers versatile reactivity, making it ideal for the creation of complex bioactive molecules. This compound is commonly employed in the synthesis of therapeutic agents, particularly in the development of anticancer, antiviral, and anti-inflammatory drugs. Its structure allows for further chemical modifications, facilitating the design of novel compounds and playing a crucial role in medicinal chemistry and drug discovery efforts.
CAS Number | 893730-96-6 |
Molecular Formula | C11H8ClNO3 |
Purity | ≥95% |
IUPAC Name | methyl 6-chloro-3-formyl-1H-indole-2-carboxylate |
InChI | InChI=1S/C11H8ClNO3/c1-16-11(15)10-8(5-14)7-3-2-6(12)4-9(7)13-10/h2-5,13H,1H3 |
InChIKey | GKXMWERDCUFMMP-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C2=C(N1)C=C(C=C2)Cl)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |