For research use only. Not for therapeutic Use.
Methyl 6-chloro-5-fluoropyrazine-2-carboxylate (Cat.No:L003388) is a notable chemical compound with versatile applications in pharmaceutical research. Its distinct pyrazine scaffold, bearing both chlorine and fluorine atoms, makes it a valuable building block in drug synthesis. This compound plays a pivotal role in the development of novel pharmaceuticals, underscoring its significance in modern medicinal chemistry endeavors.
CAS Number | 1823378-45-5 |
Molecular Formula | C6H4ClFN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 6-chloro-5-fluoropyrazine-2-carboxylate |
InChI | InChI=1S/C6H4ClFN2O2/c1-12-6(11)3-2-9-5(8)4(7)10-3/h2H,1H3 |
InChIKey | BAZSVXVRLVPSAP-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CN=C(C(=N1)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |