For research use only. Not for therapeutic Use.
Methyl 6-ethenylpyridine-2-carboxylate(Cat No.:L025070)is a pyridine derivative featuring a methyl ester group at the 2-position and an ethenyl group at the 6-position. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure allows for versatile chemical modifications, making it valuable in medicinal chemistry and material science. With high purity and stability, Methyl 6-ethenylpyridine-2-carboxylate is essential for research and development in creating novel bioactive molecules and advanced materials.
CAS Number | 103441-73-2 |
Molecular Formula | C9H9NO2 |
Purity | ≥95% |
IUPAC Name | methyl 6-ethenylpyridine-2-carboxylate |
InChI | InChI=1S/C9H9NO2/c1-3-7-5-4-6-8(10-7)9(11)12-2/h3-6H,1H2,2H3 |
InChIKey | MJAGAAYXKQNLFQ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=CC(=N1)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |