For research use only. Not for therapeutic Use.
Methyl 6-methylpyrimidine-4-carboxylate(Cat No.:L033903)is a pyrimidine derivative widely used in pharmaceutical and organic chemistry research. With a methyl group at the 6-position and a carboxylate ester at the 4-position of the pyrimidine ring, this compound serves as a key intermediate in the synthesis of various bioactive molecules, including potential therapeutic agents. Its structure makes it particularly valuable in creating heterocyclic compounds, facilitating the development of novel drugs and agrochemicals. This compound is essential in drug discovery, enabling the exploration of new pharmacological pathways.
CAS Number | 73955-53-0 |
Molecular Formula | C7H8N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 6-methylpyrimidine-4-carboxylate |
InChI | InChI=1S/C7H8N2O2/c1-5-3-6(7(10)11-2)9-4-8-5/h3-4H,1-2H3 |
InChIKey | NFDAXWQMJFTLRZ-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=N1)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |