For research use only. Not for therapeutic Use.
Methyl 6-oxo-1,6-dihydropyridine-2-carboxylate(CAT: L043898) is a high-purity heterocyclic compound essential for pharmaceutical and chemical research. Featuring a 6-oxo group and a methyl carboxylate moiety, this versatile molecule serves as a key building block in the synthesis of bioactive intermediates, including pyridine derivatives and related frameworks. Its unique structure allows for targeted modifications, making it valuable in medicinal chemistry, drug discovery, and material science. With excellent stability and defined reactivity, Methyl 6-oxo-1,6-dihydropyridine-2-carboxylate is ideal for advanced chemical transformations, enabling the development of innovative compounds and facilitating high-precision research.
CAS Number | 30062-34-1 |
Molecular Formula | C7H7NO3 |
Purity | ≥95% |
IUPAC Name | methyl 6-oxo-1H-pyridine-2-carboxylate |
InChI | InChI=1S/C7H7NO3/c1-11-7(10)5-3-2-4-6(9)8-5/h2-4H,1H3,(H,8,9) |
InChIKey | GJLWQAUHCDNAEK-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=CC(=O)N1 |