For research use only. Not for therapeutic Use.
Methyl 6-phenylnicotinate (Cat.No:L003610) is a notable organic compound widely utilized in pharmaceutical research. Its structure incorporates a phenyl-substituted nicotinic acid moiety, conferring unique pharmacological properties. This compound is employed as a valuable intermediate in the synthesis of various pharmaceutical agents, highlighting its significance in drug development processes.
| Catalog Number | L003610 |
| CAS Number | 4634-13-3 |
| Molecular Formula | C13H11NO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 6-phenylpyridine-3-carboxylate |
| InChI | InChI=1S/C13H11NO2/c1-16-13(15)11-7-8-12(14-9-11)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | DXHZSBAEWGPUKI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)C2=CC=CC=C2 |
