For research use only. Not for therapeutic Use.
Methyl 6-phenylnicotinate (Cat.No:L003610) is a notable organic compound widely utilized in pharmaceutical research. Its structure incorporates a phenyl-substituted nicotinic acid moiety, conferring unique pharmacological properties. This compound is employed as a valuable intermediate in the synthesis of various pharmaceutical agents, highlighting its significance in drug development processes.
CAS Number | 4634-13-3 |
Molecular Formula | C13H11NO2 |
Purity | ≥95% |
IUPAC Name | methyl 6-phenylpyridine-3-carboxylate |
InChI | InChI=1S/C13H11NO2/c1-16-13(15)11-7-8-12(14-9-11)10-5-3-2-4-6-10/h2-9H,1H3 |
InChIKey | DXHZSBAEWGPUKI-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CN=C(C=C1)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |